![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| AlphaMouse/ | 2024-09-29 10:35 | - | |
| Ambilux/ | 2024-09-29 10:35 | - | |
| Battleships/ | 2024-09-29 10:35 | - | |
| BigDigit/ | 2024-09-29 10:34 | - | |
| Bingo/ | 2024-09-29 10:35 | - | |
| Biopic/ | 2024-09-29 10:34 | - | |
| BongoBox/ | 2024-09-29 10:34 | - | |
| Brainibot/ | 2024-09-29 10:34 | - | |
| C_for_PICs/ | 2024-09-29 10:35 | - | |
| Cable_Tester/ | 2024-09-29 10:35 | - | |
| Camera_Watch/ | 2024-09-29 10:34 | - | |
| Camera_Watch_Mk2/ | 2024-09-29 10:35 | - | |
| Carillon/ | 2024-09-29 10:34 | - | |
| Chromatone/ | 2024-09-29 10:34 | - | |
| DICELOTT/ | 2024-09-29 10:34 | - | |
| DIGISERV/ | 2024-09-29 10:34 | - | |
| Deep_Cycle_Battery_Charger/ | 2024-09-29 10:34 | - | |
| DriverAlert/ | 2024-09-29 10:35 | - | |
| EarthRes_2003/ | 2024-09-29 10:35 | - | |
| Earthmtr_1997/ | 2024-09-29 10:34 | - | |
| Electrocardiograph/ | 2024-09-29 10:34 | - | |
| Energy_Meter/ | 2024-09-29 10:35 | - | |
| Enigma/ | 2024-09-29 10:35 | - | |
| Failsafe/ | 2024-09-29 10:35 | - | |
| FidoPed/ | 2024-09-29 10:34 | - | |
| Flexitimer/ | 2024-09-29 10:35 | - | |
| Floating_Point/ | 2024-09-29 10:35 | - | |
| FreeBird/ | 2024-09-29 10:35 | - | |
| Freezer/ | 2024-09-29 10:34 | - | |
| Frequency Meter 50MHz/ | 2024-09-29 10:35 | - | |
| Frequency Meter 50MHz Mk2/ | 2024-09-29 10:34 | - | |
| FrostBox/ | 2024-09-29 10:34 | - | |
| Fruit_Machine/ | 2024-09-29 10:34 | - | |
| GAMECOMP/ | 2024-09-29 10:35 | - | |
| GPS to PIC and PC/ | 2024-09-29 10:34 | - | |
| GardenLights/ | 2024-09-29 10:35 | - | |
| Geiger_Counter/ | 2024-09-29 10:35 | - | |
| Gscope/ | 2024-09-29 10:35 | - | |
| Halloween/ | 2024-09-29 10:35 | - | |
| ICEbreaker/ | 2024-09-29 10:35 | - | |
| ICtester/ | 2024-09-29 10:35 | - | |
| IRdecoder/ | 2024-09-29 10:35 | - | |
| Interrupts/ | 2024-09-29 10:35 | - | |
| LED_high_intensity_torch-flashlight/ | 2024-09-29 10:35 | - | |
| LED_message_display/ | 2024-09-29 10:34 | - | |
| MIDI-drumkit/ | 2024-09-29 10:35 | - | |
| MIDICV/ | 2024-09-29 10:35 | - | |
| MIDI_Activity_Detector/ | 2024-09-29 10:34 | - | |
| MIDI_health_check/ | 2024-09-29 10:34 | - | |
| MIDIpedal/ | 2024-09-29 10:35 | - | |
| MPASM/ | 2024-09-29 10:34 | - | |
| MagicMusic/ | 2024-09-29 10:35 | - | |
| Mains Monitor/ | 2024-09-29 10:35 | - | |
| MidiSynchronome/ | 2024-09-29 10:35 | - | |
| MindPICkler/ | 2024-09-29 10:35 | - | |
| MindTrainer/ | 2024-09-29 10:34 | - | |
| Monopoly_Money/ | 2024-09-29 10:35 | - | |
| Morse/ | 2024-09-29 10:34 | - | |
| NIM/ | 2024-09-29 10:35 | - | |
| PCLATH/ | 2024-09-29 10:35 | - | |
| PC_Controlled_Burglar_Alarm/ | 2024-09-29 10:34 | - | |
| PIC-ElectricMk2/ | 2024-09-29 10:34 | - | |
| PIC-midi-wave-sound-generator/ | 2024-09-29 10:35 | - | |
| PIC.Digilog/ | 2024-09-29 10:35 | - | |
| PICAGORA/ | 2024-09-29 10:35 | - | |
| PICALTIM/ | 2024-09-29 10:35 | - | |
| PICAPEST/ | 2024-09-29 10:35 | - | |
| PICATUNE/ | 2024-09-29 10:34 | - | |
| PIC Car Computer/ | 2024-09-29 10:35 | - | |
| PICDESCA/ | 2024-09-29 10:34 | - | |
| PICELECT/ | 2024-09-29 10:34 | - | |
| PICMetOffice/ | 2024-09-29 10:34 | - | |
| PIC MoonTide/ | 2024-09-29 10:35 | - | |
| PICMoonclock/ | 2024-09-29 10:34 | - | |
| PICNOUGH/ | 2024-09-29 10:34 | - | |
| PICOLO/ | 2024-09-29 10:34 | - | |
| PICPROG/ | 2024-09-29 10:35 | - | |
| PICTOCK/ | 2024-09-29 10:35 | - | |
| PICTUTOR/ | 2024-09-29 10:35 | - | |
| PIC Watering Timer/ | 2024-09-29 10:35 | - | |
| PIC_LCF_Meter/ | 2024-09-29 10:34 | - | |
| PIC_Tug_of_War/ | 2024-09-29 10:34 | - | |
| PIC_Tutorial_V2/ | 2024-09-29 10:34 | - | |
| PIC_to_keyboard and mouse/ | 2024-09-29 10:34 | - | |
| PIC_ultrasonic_radar/ | 2024-09-29 10:34 | - | |
| PICacolour/ | 2024-09-29 10:34 | - | |
| PICalarm/ | 2024-09-29 10:35 | - | |
| PICflasher/ | 2024-09-29 10:35 | - | |
| PICgen/ | 2024-09-29 10:35 | - | |
| PICkeys/ | 2024-09-29 10:34 | - | |
| PICmagnetometry/ | 2024-09-29 10:35 | - | |
| PICmem/ | 2024-09-29 10:34 | - | |
| PICmonpsu/ | 2024-09-29 10:34 | - | |
| PICnMix/ | 2024-09-29 10:35 | - | |
| PICprinter/ | 2024-09-29 10:34 | - | |
| PICronos/ | 2024-09-29 10:34 | - | |
| PICscorer/ | 2024-09-29 10:35 | - | |
| PICtogram/ | 2024-09-29 10:35 | - | |
| PICtoolkit/ | 2024-09-29 10:34 | - | |
| PICtoolkit2/ | 2024-09-29 10:34 | - | |
| PICtricks/ | 2024-09-29 10:35 | - | |
| PICvscope/ | 2024-09-29 10:35 | - | |
| PULSTAR/ | 2024-09-29 10:35 | - | |
| PainMonitor/ | 2024-09-29 10:35 | - | |
| Picaxe/ | 2024-09-29 10:34 | - | |
| Polyphonium/ | 2024-09-29 10:34 | - | |
| Programmable_Robot/ | 2024-09-29 10:34 | - | |
| Propeller_Monitor/ | 2024-09-29 10:35 | - | |
| QuickStep/ | 2024-09-29 10:34 | - | |
| RCMETER/ | 2024-09-29 10:34 | - | |
| RC_switcher/ | 2024-09-29 10:34 | - | |
| RC_switcher_Nov05/ | 2024-09-29 10:34 | - | |
| REACTION/ | 2024-09-29 10:35 | - | |
| REVCOUNT/ | 2024-09-29 10:34 | - | |
| RainbowLights/ | 2024-09-29 10:34 | - | |
| RandomFlasher/ | 2024-09-29 10:34 | - | |
| Safety_Interface/ | 2024-09-29 10:35 | - | |
| Seismograph/ | 2024-09-29 10:35 | - | |
| Serial-IO-Controller/ | 2024-09-29 10:35 | - | |
| SerialOCX/ | 2024-09-29 10:34 | - | |
| Signals_Control/ | 2024-09-29 10:35 | - | |
| SmartKart/ | 2024-09-29 10:35 | - | |
| Sneaky/ | 2024-09-29 10:35 | - | |
| Snooker/ | 2024-09-29 10:34 | - | |
| Speech_Synthesiser/ | 2024-09-29 10:35 | - | |
| Speedo Corrector/ | 2024-09-29 10:34 | - | |
| Standby Power Saver/ | 2024-09-29 10:34 | - | |
| StyloPIC/ | 2024-09-29 10:35 | - | |
| Sudoku/ | 2024-09-29 10:35 | - | |
| Sundial/ | 2024-09-29 10:35 | - | |
| Swimming_Pool_Counter/ | 2024-09-29 10:34 | - | |
| TASM/ | 2024-09-29 10:35 | - | |
| TIMEMACH/ | 2024-09-29 10:35 | - | |
| TapeMeasure/ | 2024-09-29 10:34 | - | |
| Telephone_Alarm_Dialler/ | 2024-09-29 10:35 | - | |
| Telescope-GPS/ | 2024-09-29 10:35 | - | |
| ToolkitTK3/ | 2024-09-29 10:34 | - | |
| TuningFork/ | 2024-09-29 10:35 | - | |
| USB/ | 2024-09-29 10:35 | - | |
| V2_PC_Scope/ | 2024-09-29 10:35 | - | |
| V8_Doorbell/ | 2024-09-29 10:35 | - | |
| Versatile_PIC_Flasher/ | 2024-09-29 10:35 | - | |
| VirusZapper-MK2/ | 2024-09-29 10:35 | - | |
| VirusZapper/ | 2024-09-29 10:35 | - | |
| Vplane/ | 2024-09-29 10:35 | - | |
| WATERWIZ/ | 2024-09-29 10:34 | - | |
| WaterMonitor/ | 2024-09-29 10:35 | - | |
| WindTunnel/ | 2024-09-29 10:35 | - | |
| Windspeed/ | 2024-09-29 10:35 | - | |
| WorldClock/ | 2024-09-29 10:34 | - | |
| car-aircon-controller/ | 2024-09-29 10:35 | - | |
| car_instruments/ | 2024-09-29 10:35 | - | |
| cordless_power_tool_charger/ | 2024-09-29 10:35 | - | |
| crossword/ | 2024-09-29 10:34 | - | |
| cybervox/ | 2024-09-29 10:34 | - | |
| datalog/ | 2024-09-29 10:34 | - | |
| digitimer/ | 2024-09-29 10:35 | - | |
| electric-mobility-buggy-monitor/ | 2024-09-29 10:34 | - | |
| eventcounter/ | 2024-09-29 10:35 | - | |
| gear-indicator/ | 2024-09-29 10:35 | - | |
| graphicslcd/ | 2024-09-29 10:34 | - | |
| handbells/ | 2024-09-29 10:35 | - | |
| interiorlamp/ | 2024-09-29 10:34 | - | |
| keypad_alarm/ | 2024-09-29 10:35 | - | |
| lottery/ | 2024-09-29 10:35 | - | |
| microprobe/ | 2024-09-29 10:34 | - | |
| moodPICker/ | 2024-09-29 10:35 | - | |
| moodloop/ | 2024-09-29 10:35 | - | |
| multichannel/ | 2024-09-29 10:35 | - | |
| picscope/ | 2024-09-29 10:35 | - | |
| polywhatsit/ | 2024-09-29 10:34 | - | |
| pulsometer/ | 2024-09-29 10:35 | - | |
| remote/ | 2024-09-29 10:34 | - | |
| spectrum/ | 2024-09-29 10:34 | - | |
| stopwatch/ | 2024-09-29 10:34 | - | |
| synclock/ | 2024-09-29 10:34 | - | |
| tide/ | 2024-09-29 10:34 | - | |
| timedate/ | 2024-09-29 10:35 | - | |
| universal_led_lighting_system/ | 2024-09-29 10:35 | - | |
| videocleaner/ | 2024-09-29 10:35 | - | |
| wireless/ | 2024-09-29 10:34 | - | |
| xmaslights/ | 2024-09-29 10:34 | - | |